CAS 23789-34-6
:alpha-Furil dioxime (beta- u- gamma form free)
Description:
Alpha-Furil dioxime, with the CAS number 23789-34-6, is an organic compound characterized by its dioxime functional groups attached to a furfural backbone. This compound typically exhibits properties such as being a white to off-white crystalline solid, which is soluble in polar solvents like water and alcohols. The presence of dioxime groups contributes to its ability to form chelates with metal ions, making it useful in various applications, including analytical chemistry and metal ion extraction. Alpha-Furil dioxime is known for its stability under normal conditions, although it may undergo decomposition when exposed to strong acids or bases. Additionally, it has potential applications in the synthesis of other organic compounds and in the field of coordination chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact. Overall, alpha-Furil dioxime is a versatile compound with significant relevance in both industrial and research settings.
Formula:C10H8N2O4
InChI:InChI=1/C10H8N2O4/c13-11-9(7-3-1-5-15-7)10(12-14)8-4-2-6-16-8/h1-6,13-14H/b11-9+,12-10+
Synonyms:- (1Z,2Z)-1,2-di(furan-2-yl)-N,N'-dihydroxyethane-1,2-diimine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(1Z,2Z)-1,2-Di(furan-2-yl)ethane-1,2-dione dioxime
CAS:Formula:C10H8N2O4Purity:97.0%Color and Shape:SolidMolecular weight:220.1815α-Furil Dioxime
CAS:Formula:C10H8N2O4Purity:>97.0%(W)(HPLC)Color and Shape:White to Light yellow to Light red powder to crystalMolecular weight:220.18(Z,Z)-a-Furil Dioxime
CAS:Controlled ProductApplications alpha-Furil Dioxime (cas# 23789-34-6) is a useful research chemical.
Formula:C10H8N2O4Color and Shape:NeatMolecular weight:220.18



