CAS 23789-34-6: alpha-Furil dioxime (beta- u- gamma form free)

Description:Alpha-Furil dioxime, with the CAS number 23789-34-6, is an organic compound characterized by its dioxime functional groups attached to a furfural backbone. This compound typically exhibits properties such as being a white to off-white crystalline solid, which is soluble in polar solvents like water and alcohols. The presence of dioxime groups contributes to its ability to form chelates with metal ions, making it useful in various applications, including analytical chemistry and metal ion extraction. Alpha-Furil dioxime is known for its stability under normal conditions, although it may undergo decomposition when exposed to strong acids or bases. Additionally, it has potential applications in the synthesis of other organic compounds and in the field of coordination chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact. Overall, alpha-Furil dioxime is a versatile compound with significant relevance in both industrial and research settings.

Formula:C₁₀H₈N₂O₄

InChI:InChI=1/C10H8N2O4/c13-11-9(7-3-1-5-15-7)10(12-14)8-4-2-6-16-8/h1-6,13-14H/b11-9+,12-10+

Synonyms:
(1Z,2Z)-1,2-di(furan-2-yl)-N,N'-dihydroxyethane-1,2-diimine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(1Z,2Z)-1,2-Di(furan-2-yl)ethane-1,2-dione dioxime REF: IN-DA006UKDCAS: 23789-34-6	97%	185.00 €~504.00 €	Fri 25 Apr 25
α-Furil Dioxime REF: 3B-F0079CAS: 23789-34-6	>97.0%(W)(HPLC)	325.00 €~1,251.00 €	Mon 28 Apr 25
(Z,Z)-a-Furil Dioxime REF: TR-F864653CAS: 23789-34-6	- - -	92.00 €~155.00 €	Thu 05 Jun 25
±-Furil Dioxime REF: 3D-YAA78934CAS: 23789-34-6	Min. 95%	- - -	Discontinued product