
CAS 2379-81-9
:N,N′-(10,15,16,17-Tetrahydro-5,10,15,17-tetraoxo-5H-dinaphtho[2,3-a:2′,3′-i]carbazole-6,9-diyl)bis[benzamide]
Description:
N,N′-(10,15,16,17-Tetrahydro-5,10,15,17-tetraoxo-5H-dinaphtho[2,3-a:2′,3′-i]carbazole-6,9-diyl)bis[benzamide], with CAS number 2379-81-9, is a complex organic compound characterized by its unique structure that includes multiple aromatic rings and amide functional groups. This substance features a dinaphtho[2,3-a:2′,3′-i]carbazole core, which contributes to its potential as a chromophore, making it of interest in various applications such as organic electronics and photonics. The presence of tetraoxo groups indicates significant reactivity and potential for forming coordination complexes. The compound's solubility, stability, and reactivity can be influenced by the substituents on the benzamide moieties, which may also affect its biological activity. Overall, this compound exemplifies the intricate interplay of structural features that can lead to diverse chemical properties and potential applications in materials science and medicinal chemistry.
Formula:C42H23N3O6
InChI:InChI=1S/C42H23N3O6/c46-37-23-15-7-9-17-25(23)39(48)33-31(37)29(43-41(50)21-11-3-1-4-12-21)19-27-28-20-30(44-42(51)22-13-5-2-6-14-22)32-34(36(28)45-35(27)33)40(49)26-18-10-8-16-24(26)38(32)47/h1-20,45H,(H,43,50)(H,44,51)
InChI key:InChIKey=OXEFCDNMUKTKDV-UHFFFAOYSA-N
SMILES:O=C1C2=C(C(NC(=O)C3=CC=CC=C3)=CC4=C2NC=5C4=CC(NC(=O)C6=CC=CC=C6)=C7C5C(=O)C=8C(C7=O)=CC=CC8)C(=O)C=9C1=CC=CC9
Synonyms:- Benzamide, N,N′-(10,15,16,17-tetrahydro-5,10,15,17-tetraoxo-5H-dinaphtho[2,3-a:2′,3′-i]carbazole-6,9-diyl)bis-
- N,N′-(10,15,16,17-Tetrahydro-5,10,15,17-tetraoxo-5H-dinaphtho[2,3-a:2′,3′-i]carbazole-6,9-diyl)bis[benzamide]
- 5H-Dinaphtho[2,3-a:2′,3′-i]carbazole-5,10,15,17(16H)-tetrone, 6,9-dibenzamido-
- Indanthrene Olive R
- 5H-Dinaphtho[2,3-a:2′,3′-i]carbazole, benzamide deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
C.I. Vat Black 27
CAS:C.I. Vat Black 27 is a black dye.Formula:C42H23N3O6Color and Shape:SolidMolecular weight:665.65
