CAS 2380-84-9
:7-Hydroxyindole
Description:
7-Hydroxyindole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. It features a hydroxyl (-OH) group at the 7-position of the indole ring, which influences its chemical reactivity and solubility. This compound is typically a white to pale yellow solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but less soluble in water. 7-Hydroxyindole is known for its role in various biochemical processes, including its potential as a precursor in the synthesis of biologically active compounds. It exhibits properties such as fluorescence, making it useful in certain analytical applications. Additionally, it can participate in various chemical reactions, including oxidation and substitution, due to the presence of the hydroxyl group. Its derivatives and related compounds are of interest in medicinal chemistry and research, particularly in the study of neurotransmitters and other biological systems. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H7NO
InChI:InChI=1/C8H7NO/c10-7-3-1-2-6-4-5-9-8(6)7/h1-5,9-10H
SMILES:c1cc2cc[nH]c2c(c1)O
Synonyms:- 7-Indolol
- 1H-indol-7-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ref: IN-DA006UHT
25gTo inquire100gTo inquire100mg26.00€250mg46.00€1g84.00€5g221.00€10g572.00€15g604.00€7-Hydroxy-1H-indole
CAS:7-Hydroxy-1H-indoleFormula:C8H7NOPurity:≥95%Color and Shape: pale yellow solidMolecular weight:133.15g/mol7-Hydroxyindole
CAS:Please enquire for more information about 7-Hydroxyindole including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H7NOPurity:Min. 98.0 Area-%Molecular weight:133.15 g/mol7-Hydroxyindole
CAS:7-Hydroxyindole is a biochemical that is produced by wild-type strains of Escherichia coli. It has been shown to inhibit the action of an efflux pump, which is a protein that pumps drugs and other foreign substances out of the cell. The alkoxy radical reacts with 7-hydroxyindole to form a hydroperoxide intermediate. This intermediate then reacts with molecular oxygen to form hydrogen peroxide, which may be responsible for the antimicrobial activity of 7-hydoxyindole. Studies have shown that this compound can also inhibit multidrug efflux pumps in Pseudomonas aeruginosa cells, which may lead to an increase in antibiotic uptake.
Formula:C8H7NOPurity:Min. 98 Area-%Color and Shape:Off-White PowderMolecular weight:133.15 g/mol




