CAS 23806-24-8
:3-Methyl-2-thiophenecarboxylic acid
Description:
3-Methyl-2-thiophenecarboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a carboxylic acid functional group (-COOH) and a methyl group (-CH3) attached to the thiophene ring, specifically at the 3 and 2 positions, respectively. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The methyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. 3-Methyl-2-thiophenecarboxylic acid may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure allows for potential applications in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Additionally, the compound's unique properties can be leveraged in materials science and organic electronics. Overall, 3-Methyl-2-thiophenecarboxylic acid is a versatile compound with significant implications in various fields of chemistry.
Formula:C6H6O2S
InChI:InChI=1S/C6H6O2S/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8)
InChI key:InChIKey=IFLKEBSJTZGCJG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C=CS1
Synonyms:- 2-Carboxy-3-methylthiophene
- 2-Thiophenecarboxylic acid, 3-methyl-
- 3-Methyl-2-thiophenecarboxylic acid
- 3-Methylthiophene-2-Carboxylate
- 3-Methylthiophene-2-carboxylic
- Rarechem Al Bo 0517
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Methyl-2-thiophenecarboxylic Acid
CAS:Formula:C6H6O2SPurity:>98.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:142.173-Methylthiophene-2-carboxylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H6O2SPurity:98%Color and Shape:Pale cream to cream to pale brown, PowderMolecular weight:142.183-Methyl-2-thiophenecarboxylic acid
CAS:Formula:C6H6O2SPurity:98%Color and Shape:SolidMolecular weight:142.1756Ref: IN-DA0033R4
1g21.00€5g25.00€10g25.00€1kg586.00€25g49.00€2kgTo inquire5kgTo inquire100g117.00€500g309.00€3-Methylthiophene-2-carboxylic acid
CAS:3-Methylthiophene-2-carboxylic acidFormula:C6H6O2SPurity:98%Color and Shape: pale yellow solidMolecular weight:142.18g/mol3-Methylthiophene-2-carboxylic acid
CAS:Formula:C6H6O2SPurity:98%Color and Shape:SolidMolecular weight:142.17




