CAS 23814-12-2
:benzotriazole-5-carboxylic acid
Description:
Benzotriazole-5-carboxylic acid is an organic compound characterized by its triazole ring structure, which is fused to a benzene ring, and features a carboxylic acid functional group. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, making it useful in various applications. It exhibits properties such as being a corrosion inhibitor, particularly for metals, due to its ability to form stable complexes with metal ions. Additionally, benzotriazole-5-carboxylic acid is known for its UV-absorbing capabilities, which makes it valuable in protecting materials from photodegradation. Its chemical stability and low toxicity further enhance its utility in industrial applications, including coatings, plastics, and as an additive in various formulations. The compound's reactivity can be attributed to the presence of the carboxylic acid group, allowing for potential derivatization and functionalization in synthetic chemistry. Overall, benzotriazole-5-carboxylic acid is a versatile compound with significant relevance in both research and industrial contexts.
Formula:C7H5N3O2
InChI:InChI=1/C7H5N3O2/c11-7(12)4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,11,12)(H,8,9,10)
SMILES:c1cc2c(cc1C(=O)O)[nH]nn2
Synonyms:- 1H-1,2,3-Benzotriazole-5-carboxylic acid
- 5-Carboxyl Benzotriazole
- 2H-benzotriazole-5-carboxylic acid
- 1H-benzotriazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Benzotriazolecarboxylic Acid
CAS:Formula:C7H5N3O2Purity:>96.0%(T)(HPLC)Color and Shape:White to Brown powder to crystalMolecular weight:163.141H-Benzo[d][1,2,3]triazole-5-carboxylic acid
CAS:Formula:C7H5N3O2Purity:97%Color and Shape:SolidMolecular weight:163.13351H-Benzotriazole-5-carboxylic acid
CAS:1H-Benzotriazole-5-carboxylic acidFormula:C7H5N3O2Purity:≥95%Color and Shape: light brown powderMolecular weight:163.13g/mol3H-Benzotriazole-5-carboxylic acid
CAS:Formula:C7H5N3O2Purity:95.0%Color and Shape:SolidMolecular weight:163.136Benzotriazole-5-carboxylic Acid
CAS:Controlled ProductApplications Benzotriazole-5-carboxylic acid (cas# 23814-12-2) is a useful research chemical.
Formula:C7H5N3O2Color and Shape:Off-WhiteMolecular weight:163.134






