CAS 2382-10-7

2,6-Dichloro-9-methyl-9H-purine

Description:

2,6-Dichloro-9-methyl-9H-purine is a purine derivative characterized by the presence of two chlorine atoms at the 2 and 6 positions and a methyl group at the 9 position of the purine ring. This compound is typically a white to off-white crystalline solid, and it is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but has limited solubility in water. It is often used in biochemical research, particularly in studies related to nucleic acids and as a potential building block in the synthesis of various pharmaceuticals. The presence of chlorine atoms in its structure can influence its reactivity and biological activity, making it of interest in medicinal chemistry. Additionally, 2,6-Dichloro-9-methyl-9H-purine may exhibit specific interactions with enzymes or receptors due to its structural features, which can be explored for therapeutic applications. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₆H₄Cl₂N₄

InChI: InChI=1/C6H4Cl2N4/c1-12-2-9-3-4(7)10-6(8)11-5(3)12/h2H,1H3

SMILES: Cn1cnc2c(Cl)nc(Cl)nc12

Synonyms:

• 9H-Purine, 2,6-dichloro-9-methyl-
• 2,6-Dichloro-9-Methylpurine

2,6-Dichloro-9-methyl-9H-purine

CAS: 2382-10-7

Formula: C₆H₄Cl₂N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.0288

Ref: IN-DA003G36

2,6-Dichloro-9-methyl-9H-purine

CAS: 2382-10-7

2,6-Dichloro-9-methyl-9H-purine

Purity: 98%

Color and Shape: White Powder

Molecular weight: 203.03g/mol

Ref: 54-OR301325

2,6-Dichloro-9-methyl-9H-purine

CAS: 2382-10-7

Formula: C₆H₄Cl₂N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 203.03

Ref: 10-F210509