CymitQuimica logo

CAS 2382-79-8

:

N-Acetyl-L-tryptophanamide

Description:
N-Acetyl-L-tryptophanamide is a derivative of the amino acid tryptophan, characterized by the presence of an acetyl group attached to the nitrogen of the amine side chain. This compound is known for its role in biochemical research and potential applications in pharmaceuticals. It typically appears as a white to off-white crystalline powder and is soluble in polar solvents such as water and methanol, reflecting its polar nature due to the amide and acetyl functional groups. The molecular structure includes an indole ring, which contributes to its aromatic properties and potential interactions in biological systems. N-Acetyl-L-tryptophanamide is often studied for its effects on neurotransmitter pathways and may exhibit antioxidant properties. Additionally, it is important in the synthesis of various bioactive compounds and can serve as a precursor in the production of other tryptophan derivatives. As with many chemical substances, proper handling and safety precautions are essential due to its biological activity and potential effects on human health.
Formula:C13H15N3O2
InChI:InChI=1S/C13H15N3O2/c1-8(17)16-12(13(14)18)6-9-7-15-11-5-3-2-4-10(9)11/h2-5,7,12,15H,6H2,1H3,(H2,14,18)(H,16,17)/t12-/m0/s1
InChI key:InChIKey=HNGIZKAMDMBRKJ-LBPRGKRZSA-N
SMILES:C([C@H](NC(C)=O)C(N)=O)C=1C=2C(NC1)=CC=CC2
Synonyms:
  • (αS)-α-(Acetylamino)-1H-indole-3-propanamide
  • 1H-Indole-3-propanamide, α-(acetylamino)-, (S)-
  • Acetyltryptophanamide
  • 1H-Indole-3-propanamide, α-(acetylamino)-, (αS)-
  • Indole-3-propionamide, α-acetamido-, L-
Found 6 products.