CAS 23821-37-6

3-Oxo-3-(4-pyridinyl)propanenitrile

Description:

3-Oxo-3-(4-pyridinyl)propanenitrile, with the CAS number 23821-37-6, is an organic compound characterized by its functional groups, including a ketone and a nitrile. It features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the nitrile group (-C≡N) indicates that it may exhibit polar characteristics, influencing its solubility in various solvents. This compound is typically a solid at room temperature and may have a specific melting point range. Its structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties, as pyridine derivatives are often explored for such uses. Additionally, the compound may participate in various chemical reactions, including nucleophilic additions and cycloadditions, due to the reactivity of its functional groups. Overall, 3-Oxo-3-(4-pyridinyl)propanenitrile is a versatile compound with significant implications in organic synthesis and medicinal chemistry.

Formula: C₈H₆N₂O

InChI: InChI=1/C8H6N2O/c9-4-1-8(11)7-2-5-10-6-3-7/h2-3,5-6H,1H2

SMILES: C(C#N)C(=O)c1ccncc1

Synonyms:

• 3-Oxo-3-(Pyridin-4-Yl)Propanenitrile
• 4-Pyridinepropanenitrile, Β-Oxo-
• 3-Oxo-3-(Pridine-4-Yl)Propanenitrile

3-Oxo-3-(pyridin-4-yl)propanenitrile

CAS: 23821-37-6

Formula: C₈H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 146.1460

Ref: IN-DA007N1Q

3-Oxo-3-(pyridin-4-yl)propanenitrile

CAS: 23821-37-6

3-Oxo-3-(pyridin-4-yl)propanenitrile

Purity: 95%

Color and Shape: Off-White Solid

Molecular weight: 146.15g/mol

Ref: 54-OR2995

3-Oxo-3-pyridin-4-ylpropanenitrile

CAS: 23821-37-6

Formula: C₈H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 146.149

Ref: 10-F068534