CAS 23821-63-8

4-(4-Methylphenyl)-2-phenyl-5-thiazoleacetic acid

Description:

4-(4-Methylphenyl)-2-phenyl-5-thiazoleacetic acid, with the CAS number 23821-63-8, is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features two aromatic groups: a para-methylphenyl group and a phenyl group, contributing to its hydrophobic characteristics and potential for various interactions in biological systems. The presence of the thiazole moiety suggests potential biological activity, as thiazole derivatives are often explored for their pharmacological properties. The carboxylic acid functional group in the structure indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. Additionally, the compound's structure may allow for various substitution patterns, influencing its reactivity and interactions with other molecules. Overall, 4-(4-Methylphenyl)-2-phenyl-5-thiazoleacetic acid is of interest in medicinal chemistry and may have applications in drug development or as a biochemical probe.

Formula: C₁₈H₁₅NO₂S

InChI: InChI=1S/C18H15NO2S/c1-12-7-9-13(10-8-12)17-15(11-16(20)21)22-18(19-17)14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,20,21)

InChI key: InChIKey=SVHRHIAVTBGMID-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(N=C(S1)C2=CC=CC=C2)C3=CC=C(C)C=C3

Synonyms:

• 5-Thiazoleacetic acid, 2-phenyl-4-p-tolyl-
• 5-Thiazoleacetic acid, 4-(4-methylphenyl)-2-phenyl-
• 2-(2-Phenyl-4-(p-tolyl)thiazol-5-yl)acetic acid
• 4-(4-Methylphenyl)-2-phenyl-5-thiazoleacetic acid
• (2-Phenyl-4-p-tolyl-thiazol-5-yl)-acetic acid

2-[4-(4-Methylphenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid

CAS: 23821-63-8

Versatile small molecule scaffold

Formula: C₁₈H₁₅NO₂S

Purity: Min. 95%

Molecular weight: 309.4 g/mol

Ref: 3D-YAA82163