CAS 23834-30-2
:N1,N1,N2-Trimethyl-N2-nitroso-1,2-ethanediamine
Description:
N1,N1,N2-Trimethyl-N2-nitroso-1,2-ethanediamine, with the CAS number 23834-30-2, is a chemical compound that belongs to the class of nitrosoamines, which are known for their potential carcinogenic properties. This compound features a nitroso group (-NO) attached to a diamine structure, specifically 1,2-ethanediamine, which is further substituted with three methyl groups. The presence of the nitroso group contributes to its reactivity, making it a subject of interest in various chemical and biological studies. Typically, nitrosoamines can undergo metabolic activation, leading to the formation of reactive intermediates that can interact with cellular macromolecules, such as DNA. As a result, compounds like N1,N1,N2-Trimethyl-N2-nitroso-1,2-ethanediamine are often studied for their implications in toxicology and cancer research. Handling such substances requires caution due to their potential health risks, and they are usually regulated in laboratory settings.
Formula:C5H13N3O
InChI:InChI=1S/C5H13N3O/c1-7(2)4-5-8(3)6-9/h4-5H2,1-3H3
InChI key:InChIKey=WDAHFRFQQRIZTK-UHFFFAOYSA-N
SMILES:N(CCN(C)C)(N=O)C
Synonyms:- 1,2-Ethanediamine, N,N,N′-trimethyl-N′-nitroso-
- 1,2-Ethanediamine, N<sup>1</sup>,N<sup>1</sup>,N<sup>2</sup>-trimethyl-N<sup>2</sup>-nitroso-
- 23834-30-2
- Ethylenediamine, N,N,N′-trimethyl-N′-nitroso-
- N,N,N′-Trimethyl-N′-nitrosoethylaminediamine
- N<sup>1</sup>,N<sup>1</sup>,N<sup>2</sup>-Trimethyl-N<sup>2</sup>-nitroso-1,2-ethanediamine
- 1,2-Ethanediamine, N1,N1,N2-trimethyl-N2-nitroso-
- N1,N1,N2-Trimethyl-N2-nitroso-1,2-ethanediamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(2-(Dimethylamino)ethyl)-N-methylnitous Amide
CAS:Controlled ProductApplications N-(2-(Dimethylamino)ethyl)-N-methylnitous Amide is a nitroamine compound that has carcinogenic effects.
References Huijbregts, M. A. J. et al.: Int. Env. Asse. and Man., 1(3), 181-244. (2005)Formula:C5H13N3OColor and Shape:NeatMolecular weight:131.176N-(2-(Dimethylamino)ethyl)-N-methylnitrous amide
CAS:N-(2-(Dimethylamino)ethyl)-N-methylnitrous amide is a nitrosamine that has been shown to cause cancer in animal studies. It is a carcinogen, which can be inhaled, ingested or absorbed through the skin. N-(2-(Dimethylamino)ethyl)-N-methylnitrous amide has been shown to cause tumours of the mammary gland, bladder and kidney in rats. N-(2-(Dimethylamino)ethyl)-N-methylnitrous amide also causes nasal cancer in rats and liver tumors in hamsters. This chemical has been classified as a Group 1 carcinogen by the International Agency for Research on Cancer (IARC).Formula:C5H13N3OPurity:(Hplc-Ms) Min. 95 Area-%Color and Shape:PowderMolecular weight:131.18 g/mol



