CymitQuimica logo

CAS 23844-66-8

:

Benzenemethanamine, a-(1-methylethyl)-, (R)-

Description:
Benzenemethanamine, α-(1-methylethyl)-, (R)-, also known as (R)-1-(1-methylethyl)benzylamine, is an organic compound characterized by its amine functional group attached to a benzyl structure. This compound features a chiral center, which contributes to its enantiomeric properties, specifically the (R)-configuration. It is typically a colorless to pale yellow liquid with a distinct amine odor. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound is often utilized in the synthesis of pharmaceuticals and agrochemicals due to its reactivity as a nucleophile. Additionally, it may exhibit biological activity, which can be leveraged in medicinal chemistry. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, Benzenemethanamine, α-(1-methylethyl)-, (R)- is a significant compound in organic synthesis and research applications.
Formula:C10H15N
InChI:InChI=1S/C10H15N/c1-8(2)10(11)9-6-4-3-5-7-9/h3-8,10H,11H2,1-2H3/t10-/m1/s1
InChI key:UVXXBSCXKKIBCH-SNVBAGLBSA-N
SMILES:CC(C)[C@H](C1=CC=CC=C1)N
Found 4 products.