CAS 2385-23-1

2-Methyl-3-phenyl-4(3H)-quinazolinone

Description:

2-Methyl-3-phenyl-4(3H)-quinazolinone, with the CAS number 2385-23-1, is an organic compound belonging to the quinazolinone class, characterized by a fused bicyclic structure that includes a quinazoline moiety. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of both methyl and phenyl groups contributes to its lipophilicity, which can influence its solubility and bioavailability. The compound's molecular structure allows for various interactions with biological targets, and it may undergo typical organic reactions such as substitution and oxidation. Additionally, its stability under standard conditions makes it suitable for various applications in medicinal chemistry and drug development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₅H₁₂N₂O

InChI: InChI=1S/C15H12N2O/c1-11-16-14-10-6-5-9-13(14)15(18)17(11)12-7-3-2-4-8-12/h2-10H,1H3

InChI key: InChIKey=LGNHCOKGKIUFDW-UHFFFAOYSA-N

SMILES: O=C1N(C(C)=NC=2C1=CC=CC2)C3=CC=CC=C3

Synonyms:

• 2-Methyl-3-phenyl-4-quinazolone
• 4(3H)-Quinazolinone, 2-methyl-3-phenyl-
• 2-Methyl-3-phenylquinazolin-4-one
• 2-Methyl-3-phenyl-4(3H)-quinazolinone
• 3-Phenyl-2-methylquinazolin-4-one

2-Methyl-3-phenyl-3,4-dihydroquinazolin-4-one

Controlled Product

CAS: 2385-23-1

2-Methyl-3-phenyl-3,4-dihydroquinazolin-4-one is a synthetic compound that has been isolated from natural sources. It is an acetonitrile derivative of the quinazolinones, which are found in plants such as Acacia species and Moringa oleifera. 2-Methyl-3-phenyl-3,4-dihydroquinazolin-4-one has been synthesized using acetylation and ring opening methods. The synthesis of this compound can be achieved by reacting aldehydes with amines or alkylating an amine with carbon source. The reaction mechanism is initiated by the formation of an imine intermediate followed by the addition of a nucleophile to form a second intermediate that undergoes dehydration to produce the desired product. Aluminium powder is used for drying the crude product and removing water.

Formula: C₁₅H₁₂N₂O

Purity: Min. 95%

Molecular weight: 236.27 g/mol

Ref: 3D-CAA38523