CAS 2385-28-6

1-Butyl-2,3-piperazinedione

Description:

1-Butyl-2,3-piperazinedione, identified by its CAS number 2385-28-6, is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a butyl group attached to the piperazine, contributing to its hydrophobic characteristics. The presence of the diketone functional groups (two carbonyl groups) in the 2 and 3 positions of the piperazine ring enhances its reactivity and potential for forming hydrogen bonds. Typically, such compounds exhibit moderate solubility in polar solvents due to the presence of the nitrogen atoms and carbonyl groups, while being less soluble in non-polar solvents. 1-Butyl-2,3-piperazinedione may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can influence biological activity. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in various chemical research fields.

Formula: C₈H₁₄N₂O₂

InChI: InChI=1S/C8H14N2O2/c1-2-3-5-10-6-4-9-7(11)8(10)12/h2-6H2,1H3,(H,9,11)

InChI key: InChIKey=WKOPXCHXDQPBAO-UHFFFAOYSA-N

SMILES: C(CCC)N1C(=O)C(=O)NCC1

Synonyms:

• 1-Butyl-2,3-dioxopiperazine
• 1-Butyl-2,3-piperazinedione
• 2,3-Piperazinedione, 1-butyl-