CAS 2385-38-8

1-benzylimidazolidin-2-one

Description:

1-Benzylimidazolidin-2-one, with the CAS number 2385-38-8, is a heterocyclic organic compound characterized by its imidazolidinone structure, which features a five-membered ring containing two nitrogen atoms and a carbonyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its molecular structure includes a benzyl group, which contributes to its lipophilicity and potential for various chemical reactivity. 1-Benzylimidazolidin-2-one is known for its applications in medicinal chemistry, particularly as a building block in the synthesis of pharmaceuticals and biologically active compounds. The presence of the imidazolidinone moiety may impart unique properties, such as the ability to participate in hydrogen bonding and act as a potential ligand in coordination chemistry. Additionally, its stability under standard conditions makes it a useful intermediate in organic synthesis. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1/C10H12N2O/c13-10-11-6-7-12(10)8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,11,13)

SMILES: c1ccc(cc1)CN1CCN=C1O

1-Benzylimidazolidin-2-one

CAS: 2385-38-8

Formula: C₁₀H₁₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.2151

Ref: IN-DA006UA5

1-Benzylimidazolidin-2-one

CAS: 2385-38-8

1-Benzylimidazolidin-2-one

Purity: 98%

Ref: 54-OR1041526

1-Benzyl-2-imidazolidinone

CAS: 2385-38-8

Formula: C₁₀H₁₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.219

Ref: 10-F312564

1-(Phenylmethyl)-2-imidazolidinone

Controlled Product

CAS: 2385-38-8

Applications 1-(Phenylmethyl)-2-imidazolidinone (cas# 2385-38-8) is a compound useful in organic synthesis.

Formula: C₁₀H₁₂N₂O

Color and Shape: Neat

Molecular weight: 176.22

Ref: TR-P335770