CAS 2385-63-9
:Liensinine perchlorate
Description:
Liensinine perchlorate is a chemical compound that is a salt formed from liensinine, an alkaloid derived from the plant species of the genus Zanthoxylum, and perchloric acid. It is characterized by its crystalline structure and is typically soluble in polar solvents, which is common for many perchlorate salts. Liensinine itself is known for its potential pharmacological properties, including effects on the central nervous system. The perchlorate ion, ClO4-, is a strong oxidizing agent and can be reactive under certain conditions, which may influence the stability and handling of the compound. Safety considerations are important when working with perchlorate salts due to their potential to form explosive mixtures under specific circumstances. As with many chemical substances, proper storage, handling, and disposal procedures should be followed to mitigate any risks associated with its use. Overall, liensinine perchlorate presents interesting properties for research, particularly in the fields of pharmacology and medicinal chemistry.
Formula:C37H42N2O6.2(HClO4)
Synonyms:- Liensinine diperchlorate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Liensinine Perchlorate
CAS:<p>Liensinine is the active constituent of plumula nelambinis with anti-hypertension.</p>Formula:C37H43ClN2O10Purity:99.80%Color and Shape:SolidMolecular weight:711.2

