CAS 23876-12-2

2-methyl-3-nitrobenzaldehyde

Description:

2-Methyl-3-nitrobenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde group with a methyl and a nitro substituent. Its molecular formula is C8H9N1O3, indicating the presence of eight carbon atoms, nine hydrogen atoms, one nitrogen atom, and three oxygen atoms. This compound typically appears as a yellow to brown solid and has a distinct aromatic odor. It is known for its reactivity due to the presence of both the aldehyde and nitro functional groups, which can participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition. The nitro group is a strong electron-withdrawing group, influencing the compound's reactivity and stability. 2-Methyl-3-nitrobenzaldehyde is used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, and other chemical compounds. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.

Formula: C₈H₇NO₃

InChI: InChI=1/C8H7NO3/c1-6-7(5-10)3-2-4-8(6)9(11)12/h2-5H,1H3

SMILES: Cc1c(cccc1N(=O)=O)C=O

Benzaldehyde,2-methyl-3-nitro-

CAS: 23876-12-2

Formula: C₈H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.1461

Ref: IN-DA007MWC

2-Methyl-3-nitrobenzaldehyde

CAS: 23876-12-2

2-Methyl-3-nitrobenzaldehyde

Purity: 98%

Molecular weight: 165.15g/mol

Ref: 54-OR77104

2-Methyl-3-nitrobenzaldehyde

CAS: 23876-12-2

Purity: 98%

Molecular weight: 165.147995

Ref: 10-F762181

2-methyl-3-nitrobenzaldehyde

CAS: 23876-12-2

2-Methyl-3-nitrobenzaldehyde is a versatile compound that has various applications in different fields. It is commonly used as a fluorescent probe for detecting collagen, growth factors, fatty acids, and porphyrins. This compound also plays a role in the synthesis of TGF-beta, ketorolac, gamma-butyrolactone, dopamine, and other important molecules. Additionally, 2-Methyl-3-nitrobenzaldehyde is known for its phase transfer properties, making it useful in halide reactions and organic synthesis. Its polymorphic form allows for different applications depending on the specific needs of the research or industry. Overall, this compound is a valuable tool for scientists and researchers working in the field of research chemicals.

Formula: C₈H₇NO₃

Purity: Min. 95%

Molecular weight: 165.1 g/mol

Ref: 3D-YAA87612