CAS 23883-45-6
:3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium chloride hydrochloride (1:1:1)
Description:
The chemical substance known as "3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium chloride hydrochloride (1:1:1)" with CAS number 23883-45-6 is a complex organic compound characterized by its thiazolium and pyrimidine moieties, which contribute to its biological activity. This compound features a thiazolium ring, which is known for its role in various biochemical processes, and a pyrimidine derivative that may enhance its interaction with biological targets. The presence of a phosphoryl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals that target specific enzymes or receptors. The chloride and hydrochloride components indicate that the compound is likely soluble in water, which is advantageous for biological assays. Overall, this substance may exhibit interesting pharmacological properties, making it a candidate for further research in drug development and therapeutic applications.
Formula:C12H20Cl2N4O7P2S
InChI:InChI=1/C12H18N4O7P2S.2ClH/c1-8-11(3-4-22-25(20,21)23-24(17,18)19)26-7-16(8)6-10-5-14-9(2)15-12(10)13;;/h5,7H,3-4,6H2,1-2H3,(H4-,13,14,15,17,18,19,20,21);2*1H
SMILES:Cc1c(CCOP(=O)([O-])OP(=O)(O)O)sc[n+]1Cc1cnc(C)[nH]c1=N.Cl.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Cocarboxylase hydrochloride
CAS:<p>Cocarboxylase hydrochloride is a coenzyme derivative, which is primarily sourced from thiamine (vitamin B1). It plays a crucial role in biochemical processes by facilitating the enzymatic decarboxylation of alpha-keto acids within the cellular environment. This action is fundamental in energy production as it aids in the conversion of pyruvate to acetyl-CoA, subsequently entering the citric acid cycle. Cocarboxylase hydrochloride’s involvement in carbohydrate metabolism is especially vital for tissues with high metabolic rates, such as the heart and brain.</p>Formula:C12H19N4O7P2S·ClHClPurity:Min. 95%Molecular weight:497.23 g/mol
