CAS 23889-85-2
:1-Phenyl-4-iodopyrazole
Description:
1-Phenyl-4-iodopyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a phenyl group at the 1-position and an iodine atom at the 4-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic phenyl group, which can influence its solubility in organic solvents. The iodine substituent can enhance the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. 1-Phenyl-4-iodopyrazole may also exhibit biological activity, making it of interest in medicinal chemistry and agrochemical applications. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug development or as a pesticide. As with many halogenated compounds, safety considerations regarding its handling and disposal are important due to potential toxicity and environmental impact.
Formula:C9H7IN2
InChI:InChI=1/C9H7IN2/c10-8-6-11-12(7-8)9-4-2-1-3-5-9/h1-7H
SMILES:c1ccc(cc1)n1cc(cn1)I
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Iodo-1-phenyl-1H-pyrazole, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H7IN2Purity:95%Color and Shape:Powder or granular solid, White to pale creamMolecular weight:270.074-Iodo-1-phenyl-1H-pyrazole
CAS:<p>4-Iodo-1-phenyl-1H-pyrazole</p>Formula:C9H7IN2Purity:98%Color and Shape:White PowderMolecular weight:270.06975g/mol
