CymitQuimica logo

CAS 239-09-8

:

11H-indolo[3,2-c]quinoline

Description:
11H-indolo[3,2-c]quinoline, with the CAS number 239-09-8, is a heterocyclic compound that features a fused indole and quinoline structure. This compound is characterized by its aromatic nature, which contributes to its stability and potential biological activity. The indole moiety consists of a benzene ring fused to a pyrrole ring, while the quinoline part includes a benzene ring fused to a pyridine ring. This unique structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit fluorescence properties. Its solubility can vary depending on the solvent, and it may participate in various chemical reactions, including electrophilic substitutions. 11H-indolo[3,2-c]quinoline has been studied for its potential pharmacological applications, including anti-cancer and anti-inflammatory activities, although further research is often necessary to fully understand its mechanisms and therapeutic potential.
Formula:C15H10N2
InChI:InChI=1/C15H10N2/c1-4-8-14-10(5-1)12-9-16-13-7-3-2-6-11(13)15(12)17-14/h1-9,17H
SMILES:c1ccc2c(c1)c1cnc3ccccc3c1[nH]2
Synonyms:
  • Tcmdc-131258
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.