CAS 239-35-0: Benzo[b]naphtho[2,1-d]thiophene
Description:Benzo[b]naphtho[2,1-d]thiophene is a polycyclic aromatic compound characterized by its fused ring structure, which includes both naphthalene and thiophene moieties. This compound is known for its planar geometry, which contributes to its potential applications in organic electronics, particularly in organic semiconductors and photovoltaic devices. It exhibits notable stability and can participate in various chemical reactions due to the presence of its aromatic rings. The compound is typically insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. Its electronic properties are influenced by the conjugated system of π-electrons, making it a subject of interest in materials science and organic chemistry research. Additionally, benzo[b]naphtho[2,1-d]thiophene may exhibit fluorescence, which can be harnessed in optoelectronic applications. Safety data indicates that, like many polycyclic aromatic hydrocarbons, it should be handled with care due to potential health risks associated with exposure.
Formula:C16H10S
InChI:InChI=1S/C16H10S/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-10H
InChI key:InChIKey=YEUHHUCOSQOCIX-UHFFFAOYSA-N
SMILES:S1C=2C=CC=CC2C=3C=CC=4C=CC=CC4C13
- Synonyms:
- 1,2-Benzo-9-Thiafluorene
- 11-Thiabenzo(A)Fluorene
- Benzo[B]Naphtho[2,1-D]Thiophene
- NSC 89259
- Naphtho(1,2:2,3)Thionaphthen
- Naphtho[1,2-b]thianaphthene

Ref: IN-DA003DBX
Undefined size | To inquire |

Benzo[b]naphtho[2,1-d]thiophene
Ref: 04-C20600000
10mg | 76.00 € |

Benzo[b]naphtho[2,1-d]thiophene 10 µg/mL in Cyclohexane
Controlled ProductRef: 04-L20600000CY
10ml | 62.00 € |

1,2-Benzodiphenylene sulfide
Ref: 3D-FB170946
1g | 1,867.00 € | ||
100mg | 355.00 € | ||
250mg | 702.00 € | ||
500mg | 1,088.00 € |

1,2-Benzo-9-thiafluorene
Controlled ProductRef: TR-B207085
25mg | 469.00 € |