CAS 2390-22-9
:3,3,3-Tris(4-chlorophenyl)-1-(4-methyl-1-piperazinyl)-1-propanone
Description:
3,3,3-Tris(4-chlorophenyl)-1-(4-methyl-1-piperazinyl)-1-propanone, with the CAS number 2390-22-9, is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic rings and a piperazine moiety. This compound typically exhibits properties associated with its chlorinated phenyl groups, such as increased lipophilicity and potential biological activity. It is often studied for its pharmacological properties, particularly in the context of its interactions with biological targets. The presence of the piperazine ring suggests potential applications in medicinal chemistry, as piperazine derivatives are known for their diverse therapeutic effects. Additionally, the compound may display significant stability under standard conditions, although specific reactivity can depend on the surrounding environment and functional groups. Safety and handling precautions are essential due to the presence of chlorine atoms, which can impart toxicity. Overall, this compound represents a class of substances that may have implications in drug development and chemical research.
Formula:C26H25Cl3N2O
InChI:InChI=1S/C26H25Cl3N2O/c1-30-14-16-31(17-15-30)25(32)18-26(19-2-8-22(27)9-3-19,20-4-10-23(28)11-5-20)21-6-12-24(29)13-7-21/h2-13H,14-18H2,1H3
InChI key:InChIKey=SWDPECKACXBPCX-UHFFFAOYSA-N
SMILES:C(CC(=O)N1CCN(C)CC1)(C2=CC=C(Cl)C=C2)(C3=CC=C(Cl)C=C3)C4=CC=C(Cl)C=C4
Synonyms:- 1-Methyl-4-(3,3,3-tris(4-chlorophenyl)propionyl)piperazine
- 1-Propanone, 3,3,3-tris(4-chlorophenyl)-1-(4-methyl-1-piperazinyl)-
- Hetolin
- Piperazine, 1-methyl-4-[3,3,3-tris(p-chlorophenyl)propionyl]-
- 3,3,3-Tris(4-chlorophenyl)-1-(4-methyl-1-piperazinyl)-1-propanone
- Piperazine, 1-methyl-4-[3,3,3-tris(4-chlorophenyl)-1-oxopropyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
