CymitQuimica logo

CAS 23903-48-2

:

N-(3-Cyano-4,5,6,7-tetrahydrobenzo[b]thien-2-yl)benzamide

Description:
N-(3-Cyano-4,5,6,7-tetrahydrobenzo[b]thien-2-yl)benzamide is a chemical compound characterized by its unique structure, which includes a benzamide moiety and a tetrahydrobenzo[b]thienyl group substituted with a cyano group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its structural features. The presence of the cyano group may enhance its reactivity and solubility in various solvents, while the tetrahydrobenzo[b]thienyl structure contributes to its stability and potential interactions with biological targets. The compound may be of interest in medicinal chemistry for its potential pharmacological properties, particularly in the development of new therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR, mass spectrometry, and IR spectroscopy to confirm its structure and purity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H14N2OS
InChI:InChI=1S/C16H14N2OS/c17-10-13-12-8-4-5-9-14(12)20-16(13)18-15(19)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-9H2,(H,18,19)
InChI key:InChIKey=OKFHWMLGUMHKFC-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(SC1NC(=O)C3=CC=CC=C3)CCCC2
Synonyms:
  • NSC 153311
  • N-(3-Cyano-4,5,6,7-tetrahydrobenzo[b]thien-2-yl)benzamide
  • Benzamide, N-(3-cyano-4,5,6,7-tetrahydrobenzo[b]thien-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.