CAS 239074-29-4
:tert-Butyl [trans-4-(hydroxymethyl)cyclohexyl]carbamate
Description:
Tert-Butyl [trans-4-(hydroxymethyl)cyclohexyl]carbamate is a chemical compound characterized by its carbamate functional group, which is derived from the reaction of an amine and a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance and influencing its solubility and reactivity. The presence of the trans-4-(hydroxymethyl)cyclohexyl moiety indicates a specific stereochemistry that can affect the compound's biological activity and interactions. Typically, compounds like this may exhibit properties such as moderate polarity due to the hydroxymethyl group, which can engage in hydrogen bonding. The tert-butyl group contributes to the overall hydrophobic character, potentially impacting its solubility in various solvents. Additionally, the compound may be of interest in pharmaceutical applications, particularly in drug design, due to its structural features that can influence binding affinity and selectivity for biological targets. As with many organic compounds, stability, reactivity, and potential applications can vary based on environmental conditions and the presence of other functional groups.
Formula:C12H23NO3
InChI:InChI=1/C12H23NO3/c1-12(2,3)16-11(15)13-10-6-4-9(8-14)5-7-10/h9-10,14H,4-8H2,1-3H3,(H,13,15)/t9-,10-
SMILES:CC(C)(C)OC(=N[C@H]1CC[C@@H](CC1)CO)O
Synonyms:- trans-N-[4-(Hydroxymethyl)cyclohexyl]carbamic acid tert-butyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
trans-1-(Boc-amino)-4-(hydroxymethyl)cyclohexane, 97%
CAS:trans-1-(Boc-amino)-4-(hydroxymethyl)cyclohexane is used to prepare C-2 hydroxyethyl imidazopyrrolo pyridines as JAK1 inhibitors. It is also used to prepare Mer kinase inhibitors for treatment of pediatric acute lymphoblastic leukemia. This Thermo Scientific Chemicals brand product was originally paFormula:C12H23NO3Purity:97%Molecular weight:229.31Tert-Butyl Trans-(4-Hydroxymethyl)Cyclohexylcarbamate
CAS:Formula:C12H23NO3Purity:95%Color and Shape:SolidMolecular weight:229.3159tert-Butyl (trans-4-(hydroxymethyl)cyclohexyl)carbamate
CAS:tert-Butyl (trans-4-(hydroxymethyl)cyclohexyl)carbamatePurity:97%Molecular weight:229.32g/molTERT-BUTYL TRANS-4-(HYDROXYMETHYL)CYCLOHEXYLCARBAMATE
CAS:Formula:C12H23NO3Purity:95%Color and Shape:SolidMolecular weight:229.32tert-Butyl trans-4-(hydroxymethyl)cyclohexylcarbamate
CAS:Please enquire for more information about tert-Butyl trans-4-(hydroxymethyl)cyclohexylcarbamate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C12H23NO3Purity:Min. 95%Molecular weight:229.32 g/mol




