CAS 239087-09-3
:3-Fluoro-5-(trifluoromethyl)benzyl bromide
Description:
3-Fluoro-5-(trifluoromethyl)benzyl bromide is an organic compound characterized by its aromatic structure, featuring a benzyl group substituted with both a fluorine atom and a trifluoromethyl group. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The trifluoromethyl group is known for imparting unique electronic properties, often increasing lipophilicity and influencing biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle this substance with care, as it may pose health risks, including potential toxicity and environmental hazards. Proper safety measures, including the use of personal protective equipment and adherence to regulatory guidelines, are essential when working with this compound. Its applications in synthetic organic chemistry highlight its significance in the field of medicinal chemistry and material science.
Formula:C8H5BrF4
InChI:InChI=1/C8H5BrF4/c9-4-5-1-6(8(11,12)13)3-7(10)2-5/h1-3H,4H2
SMILES:c1c(cc(cc1C(F)(F)F)F)CBr
Synonyms:- Alpha-Bromo-3-Fluoro-5-(Trifluoromethyl)Toluene
- a-Bromo-3-fluoro-5-(trifluoromethyl)toluene
- 3-Fluoro-5-(trifluoromethyl)benzylbromide-
- 1-(Bromomethyl)-3-Fluoro-5-(Trifluoromethyl)Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Fluoro-5-(trifluoromethyl)benzyl Bromide
CAS:Formula:C8H5BrF4Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:257.031-(Bromomethyl)-3-fluoro-5-(trifluoromethyl)benzene
CAS:Formula:C8H5BrF4Purity:97%Color and Shape:LiquidMolecular weight:257.02293-Fluoro-5-(trifluoromethyl)benzyl bromide
CAS:3-Fluoro-5-(trifluoromethyl)benzyl bromideFormula:C8H5BrF4Purity:98%Color and Shape:LiquidMolecular weight:257.02g/mol3-Fluoro-5-(trifluoromethyl)benzyl bromide
CAS:Formula:C8H5BrF4Purity:98.0%Color and Shape:LiquidMolecular weight:257.0263-Fluoro-5-(trifluoromethyl)benzyl bromide
CAS:Please enquire for more information about 3-Fluoro-5-(trifluoromethyl)benzyl bromide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H5BrF4Purity:Min. 95%Molecular weight:257.02 g/mol




