CAS 23911-56-0

1-(3-Methyl-2-benzofuranyl)ethanone

Description:

1-(3-Methyl-2-benzofuranyl)ethanone, with the CAS number 23911-56-0, is an organic compound characterized by its unique structure, which includes a benzofuran moiety and an ethanone functional group. This compound typically exhibits a molecular formula that reflects its composition of carbon, hydrogen, and oxygen atoms. It is known for its aromatic properties due to the presence of the benzofuran ring, which contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis. The compound may display moderate to low solubility in water, while being more soluble in organic solvents, a characteristic common to many aromatic compounds. Its reactivity can be influenced by the functional groups present, allowing for potential transformations in chemical reactions. Additionally, the presence of the methyl group can affect its physical properties, such as boiling and melting points, as well as its overall stability. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₁H₁₀O₂

InChI: InChI=1S/C11H10O2/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3

InChI key: InChIKey=MTNZPWYMBRSDTL-UHFFFAOYSA-N

SMILES: CC=1C=2C(OC1C(C)=O)=CC=CC2

Synonyms:

• Ethanone, 1-(3-methyl-2-benzofuranyl)-
• 2-Acetyl-3-methylbenzofuran
• Ketone, methyl 3-methyl-2-benzofuranyl
• Nerolione
• 1-(3-Methyl-2-benzofuranyl)ethanone

1-(3-Methylbenzofuran-2-yl)ethanone

CAS: 23911-56-0

Formula: C₁₁H₁₀O₂

Molecular weight: 174.1959

Ref: IN-DA00BHB8