CAS 23912-79-0

Pentacenetetrone

Description:

Pentacenetetrone, identified by the CAS number 23912-79-0, is a polycyclic aromatic compound characterized by its unique structure, which consists of five interconnected benzene rings with ketone functional groups. This compound exhibits notable stability due to its extensive conjugated π-electron system, which contributes to its electronic properties and potential applications in organic electronics and materials science. Pentacenetetrone is typically insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. The presence of ketone groups introduces polar characteristics, which can influence its reactivity and interactions with other chemical species. Additionally, pentacenetetrone may exhibit interesting optical properties, such as fluorescence or phosphorescence, making it a subject of interest in photonic applications. Its synthesis often involves complex organic reactions, and its study can provide insights into the behavior of larger polycyclic aromatic hydrocarbons. Overall, pentacenetetrone represents a fascinating area of research within organic chemistry, particularly in the context of advanced materials and electronic devices.

Formula: C₂₂H₁₀O₄

InChI: InChI=1/C22H10O4/c23-19-11-5-1-2-6-12(11)20(24)16-10-18-17(9-15(16)19)21(25)13-7-3-4-8-14(13)22(18)26/h1-10H

SMILES: c1ccc2c(c1)c(=O)c1cc3c(cc1c2=O)c(=O)c1ccccc1c3=O

Synonyms:

• 5,7,12,14-Pentacenetetrone
• Pentacene-5,7,12,14-Tetrone

5,7,12,14-Pentacenetetrone

CAS: 23912-79-0

Formula: C₂₂H₁₀O₄

Purity: >95.0%(HPLC)

Color and Shape: White to Green to Brown powder to lump

Molecular weight: 338.32

Ref: 3B-P1710

5,7,12,14-Pentacenetetrone

CAS: 23912-79-0

Formula: C₂₂H₁₀O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 338.3124

Ref: IN-DA003MAG

5,7,12,14-Pentacenetetrone

CAS: 23912-79-0

5,7,12,14-Pentacenetetrone

Purity: 98%

Molecular weight: 338.31g/mol

Ref: 54-OR1027093

Pentacene-5,7,12,14-tetraone

CAS: 23912-79-0

Purity: 98%

Molecular weight: 338.3179931640625

Ref: 10-F731119

5,7,12,14-Pentacenetetrone

CAS: 23912-79-0

Pentacenetetrone is an organic solvent that can be used to dissolve a wide variety of substances. It has been shown to have inhibitory effects on molecules. The redox potentials of pentacenetetrone can be tuned by the addition of metal ions or electron donors and acceptors, which allows it to act as a rechargeable battery. In the presence of oxygen, pentacenetetrone will react with molecular oxygen and form the anion radical, which is a reactive species. Pentacenetetrone is also capable of forming heterostructures with metals such as copper and gold.

Formula: C₂₂H₁₀O₄

Purity: Min. 95%

Molecular weight: 338.31 g/mol

Ref: 3D-FP02088