CymitQuimica logo

CAS 239135-52-5

:

5-Fluoro-2-(trifluoromethyl)phenylacetic acid

Description:
5-Fluoro-2-(trifluoromethyl)phenylacetic acid is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with both a fluorine atom and a trifluoromethyl group, along with an acetic acid moiety. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents. Its molecular formula reflects the presence of multiple fluorine atoms, which contribute to its chemical stability and potential reactivity. The presence of the trifluoromethyl group often enhances lipophilicity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the fluorine substituents can influence the compound's biological activity, potentially affecting its interaction with biological targets. As with many fluorinated compounds, it may exhibit unique properties such as increased metabolic stability and altered pharmacokinetics. Safety data should be consulted for handling and usage, as fluorinated compounds can pose specific health and environmental risks.
Formula:C9H6F4O2
InChI:InChI=1/C9H6F4O2/c10-6-1-2-7(9(11,12)13)5(3-6)4-8(14)15/h1-3H,4H2,(H,14,15)
InChI key:GWWZRGDMAFXULO-UHFFFAOYSA-N
SMILES:c1cc(c(cc1F)CC(=O)O)C(F)(F)F
Synonyms:
  • [5-Fluoro-2-(trifluoromethyl)phenyl]acetic acid
  • 239135-52-5
  • Benzeneacetic acid, 5-fluoro-2-(trifluoromethyl)-
  • Qv1R Cf Fxfff
Found 4 products.