CAS 239135-55-8
:2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
Description:
2-Amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid is a heterocyclic compound featuring a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound is characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its acidic properties. The trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The thiazole structure is known for its role in various biological activities, including antimicrobial and antifungal properties. The compound's solubility and reactivity can be affected by the functional groups present, particularly the carboxylic acid, which can participate in hydrogen bonding and affect its interaction with other molecules. Its CAS number, 239135-55-8, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, this compound's unique structure and functional groups make it a valuable subject of study in organic and medicinal chemistry.
Formula:C5H3F3N2O2S
InChI:InChI=1/C5H3F3N2O2S/c6-5(7,8)2-1(3(11)12)13-4(9)10-2/h(H2,9,10)(H,11,12)
SMILES:c1(c(C(F)(F)F)[nH]c(=N)s1)C(=O)O
Synonyms:- 5-Thiazolecarboxylic acid, 2-amino-4-(trifluoromethyl)-
- 2-Amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
CAS:Formula:C5H3F3N2O2SPurity:98%Color and Shape:SolidMolecular weight:212.14972-Amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
CAS:<p>2-Amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid</p>Formula:C5H3F3N2O2SPurity:95%Color and Shape: yellow powderMolecular weight:212.15g/mol2-Amino-4-(trifluoromethyl)thiazole-5-carboxylic acid
CAS:Please enquire for more information about 2-Amino-4-(trifluoromethyl)thiazole-5-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C5H3F3N2O2SPurity:Min. 95%Molecular weight:212.15 g/mol2-Amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
CAS:Formula:C5H3F3N2O2SPurity:98%Color and Shape:SolidMolecular weight:212.15



