CAS 2393-18-2
:3-(4-Aminophenyl)-2-propenoic acid
Description:
3-(4-Aminophenyl)-2-propenoic acid, also known as 4-Aminocinnamic acid, is an organic compound characterized by its structure, which features an amino group (-NH2) attached to a phenyl ring that is further connected to a propenoic acid moiety. This compound typically appears as a solid and is soluble in polar solvents like water and alcohols due to the presence of the carboxylic acid group. It exhibits both acidic and basic properties, allowing it to participate in various chemical reactions, including polymerization and coupling reactions. The amino group can engage in hydrogen bonding, enhancing its reactivity and potential applications in pharmaceuticals and materials science. Additionally, 3-(4-Aminophenyl)-2-propenoic acid is of interest in the field of organic synthesis and may serve as a precursor for dyes, agrochemicals, and other functional materials. Its biological activity may also be explored in medicinal chemistry, particularly in the development of compounds with anti-inflammatory or anticancer properties.
Formula:C9H9NO2
InChI:InChI=1S/C9H9NO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,10H2,(H,11,12)
InChI key:InChIKey=JOLPMPPNHIACPD-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC=C(N)C=C1
Synonyms:- (2E)-3-(4-aminophenyl)prop-2-enoic acid
- (Z)-3-(4-aminophenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-(4-aminophenyl)-
- 3-(4-Aminophenyl)-2-propenoic acid
- 4-Aminocinnamic acid
- Cinnamic acid, p-amino-
- NSC 1780
- p-Aminocinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(E)-4-Aminocinnamic Acid
CAS:Formula:C9H9NO2Purity:>98.0%(T)(HPLC)Color and Shape:Light yellow to Brown to Dark green powder to crystalMolecular weight:163.184-Aminocinnamic acid
CAS:4-Aminocinnamic acidFormula:C9H9NO2Purity:97%Color and Shape: brown powderMolecular weight:163.17326g/mol4-Aminocinnamic acid
CAS:4-Aminocinnamic acid is a monomer that can be polymerized to form polymers. It is soluble in organic solvents and is resistant to UV light. 4-Aminocinnamic acid has been shown to have photochemical properties and can be used to produce hydrogen bonds with other molecules. This compound has been used as a carbon source for microbial growth and has been shown to be an effective genetic control agent for the bacteria Escherichia coli. 4-Aminocinnamic acid has also been shown to inhibit the growth of butyric acid producing bacteria, such as Clostridium butyricum, while promoting the growth of lactic acid producing bacteria, such as Lactobacillus plantarum.
Formula:C9H9NO2Purity:90%Color and Shape:PowderMolecular weight:163.17 g/mol3-(4-Aminophenyl)acrylic acid
CAS:Formula:C9H9NO2Purity:95%Color and Shape:SolidMolecular weight:163.176




