CAS 2393-58-0: α-Muricholic acid
Description:α-Muricholic acid is a bile acid that is primarily found in rodents and is a derivative of cholic acid. It is characterized by its unique structure, which includes a hydroxyl group at the 3-position and a double bond between the 5 and 6 positions of the steroid nucleus. This compound plays a significant role in the digestion and absorption of dietary fats and fat-soluble vitamins. α-Muricholic acid is known for its ability to influence lipid metabolism and has been studied for its potential effects on metabolic disorders. It exhibits amphipathic properties, allowing it to interact with both hydrophilic and hydrophobic substances, which is crucial for its function in emulsifying fats in the intestine. Additionally, it has been shown to have various biological activities, including potential anti-inflammatory effects. The compound is of interest in research related to metabolism, obesity, and liver function, making it a valuable subject in the study of bile acids and their physiological roles.
Formula:C24H40O5
InChI:InChI=1S/C24H40O5/c1-13(4-7-19(26)27)15-5-6-16-20-17(9-11-23(15,16)2)24(3)10-8-14(25)12-18(24)21(28)22(20)29/h13-18,20-22,25,28-29H,4-12H2,1-3H3,(H,26,27)/t13-,14-,15-,16+,17+,18+,20+,21+,22+,23-,24-/m1/s1
InChI key:InChIKey=DKPMWHFRUGMUKF-GDYCBZMLSA-N
SMILES:O=C(O)CCC(C)C1CCC2C3C(O)C(O)C4CC(O)CCC4(C)C3CCC12C
- Synonyms:
- 5β-Cholanic acid, 3α,6β,7α-trihydroxy-
- 5β-Cholan-24-oic acid, 3α,6β,7α-trihydroxy-
- α-Muricholic acid
- (3α,5β,6β,7α)-3,6,7-Trihydroxycholan-24-oic acid
- Cholan-24-oic acid, 3,6,7-trihydroxy-, (3α,5β,6β,7α)-
