CAS 2393-58-0
:α-Muricholic acid
Description:
α-Muricholic acid is a bile acid that is primarily found in rodents and is a derivative of cholic acid. It is characterized by its unique structure, which includes a hydroxyl group at the 3-position and a double bond between the 5 and 6 positions of the steroid nucleus. This compound plays a significant role in the digestion and absorption of dietary fats and fat-soluble vitamins. α-Muricholic acid is known for its ability to influence lipid metabolism and has been studied for its potential effects on metabolic disorders. It exhibits amphipathic properties, allowing it to interact with both hydrophilic and hydrophobic substances, which is crucial for its function in emulsifying fats in the intestine. Additionally, it has been shown to have various biological activities, including potential anti-inflammatory effects. The compound is of interest in research related to metabolism, obesity, and liver function, making it a valuable subject in the study of bile acids and their physiological roles.
Formula:C24H40O5
InChI:InChI=1S/C24H40O5/c1-13(4-7-19(26)27)15-5-6-16-20-17(9-11-23(15,16)2)24(3)10-8-14(25)12-18(24)21(28)22(20)29/h13-18,20-22,25,28-29H,4-12H2,1-3H3,(H,26,27)/t13-,14-,15-,16+,17+,18+,20+,21+,22+,23-,24-/m1/s1
InChI key:InChIKey=DKPMWHFRUGMUKF-GDYCBZMLSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H](CCC(O)=O)C)(CC4)[H])[H])([C@H](O)[C@@H](O)[C@@]1(C[C@H](O)CC2)[H])[H])[H]
Synonyms:- 5β-Cholanic acid, 3α,6β,7α-trihydroxy-
- 5β-Cholan-24-oic acid, 3α,6β,7α-trihydroxy-
- α-Muricholic acid
- (3α,5β,6β,7α)-3,6,7-Trihydroxycholan-24-oic acid
- Cholan-24-oic acid, 3,6,7-trihydroxy-, (3α,5β,6β,7α)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(3a,5b,6b,7a)-3,6,7-trihydroxy-Cholan-24-oic acid
CAS:Formula:C24H40O5Purity:98%Color and Shape:SolidMolecular weight:408.5714α-Muricholic acid
CAS:α-Muricholic acid is the most abundant primary bile acid in rodents.Formula:C24H40O5Purity:98%Color and Shape:SolidMolecular weight:408.57α-Muricholic Acid
CAS:Controlled ProductApplications α-Muricholic Acid is an bile acid found in urine. Studies have linked α-Muricholic in the understanding of the complex signaling pathways of hepatic lipid abnormalities with type 2 diabetes and a treatment target for this condition.
References Haeusier, R.A., et al.: Cell. Metabolism., 15, 65 (2012); Chen, K.H., et al.: Am. J. Physiol., 301, E853 (2011);Formula:C24H40O5Color and Shape:NeatMolecular weight:408.57α-Muricholic Acid-d5
CAS:Controlled ProductFormula:C24D5H35O5Color and Shape:NeatMolecular weight:413.6025β-Cholanic acid-3α,6β,7α-triol
CAS:Controlled Producta murine-specific primary bile acid. It has been shown that plasma, liver, and muscle levels of α-muricholic acid are increased in mice switched from a high-fat to low-fat diet.Formula:C24H40O5Purity:Min. 95%Molecular weight:408.57 g/mol






