CAS 2393-59-1: β-Muricholic acid
Description:β-Muricholic acid is a bile acid that is primarily found in rodents and is a derivative of cholic acid. It is characterized by its unique structure, which includes a hydroxyl group at the C-3 position and a double bond between the C-5 and C-6 positions, contributing to its biological activity. This compound plays a significant role in the metabolism of lipids and the regulation of cholesterol levels in the body. β-Muricholic acid is known to activate specific nuclear receptors, such as the farnesoid X receptor (FXR), which is involved in bile acid homeostasis and glucose metabolism. Additionally, it has been studied for its potential effects on gut microbiota and its implications in metabolic disorders. The compound is typically synthesized from cholic acid through various chemical reactions, and its solubility and stability can vary depending on the pH and the presence of other substances. Overall, β-Muricholic acid is an important molecule in the study of metabolic processes and therapeutic applications.
Formula:C24H40O5
InChI:InChI=1S/C24H40O5/c1-13(4-7-19(26)27)15-5-6-16-20-17(9-11-23(15,16)2)24(3)10-8-14(25)12-18(24)21(28)22(20)29/h13-18,20-22,25,28-29H,4-12H2,1-3H3,(H,26,27)/t13-,14-,15-,16+,17+,18+,20+,21+,22-,23-,24-/m1/s1
InChI key:InChIKey=DKPMWHFRUGMUKF-CRKPLTDNSA-N
SMILES:O=C(O)CCC(C)C1CCC2C3C(O)C(O)C4CC(O)CCC4(C)C3CCC12C
- Synonyms:
- 5β-Cholan-24-oic acid, 3α,6β,7β-trihydroxy-
- (3α,5β,6β,7β)-3,6,7-Trihydroxycholan-24-oic acid
- Cholan-24-oic acid, 3,6,7-trihydroxy-, (3α,5β,6β,7β)-
- 5β-Cholanic acid, 3α,6β,7β-trihydroxy-
- β-Muricholic acid
