CAS 2394-87-8

4,6-dichloro-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine

Description:

4,6-Dichloro-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine, with the CAS number 2394-87-8, is a chemical compound that belongs to the class of triazine derivatives. This substance is characterized by the presence of a triazine ring, which is a six-membered heterocyclic compound containing three nitrogen atoms. The compound features two chlorine atoms at the 4 and 6 positions of the triazine ring, contributing to its reactivity and potential applications in various fields. Additionally, the presence of a trifluoromethyl group attached to a phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is often studied for its potential use in agrochemicals, particularly as a herbicide or fungicide, due to its ability to inhibit specific biochemical pathways in plants. Its stability, solubility, and interaction with biological systems are important characteristics that determine its efficacy and safety in practical applications. As with many chemical substances, handling should be done with care, considering its potential environmental and health impacts.

Formula: C₁₀H₅Cl₂F₃N₄

InChI: InChI=1/C10H5Cl2F3N4/c11-7-17-8(12)19-9(18-7)16-6-3-1-2-5(4-6)10(13,14)15/h1-4H,(H,16,17,18,19)

SMILES: c1cc(cc(c1)N=c1[nH]c(Cl)nc(Cl)n1)C(F)(F)F

Synonyms:

• 1,3,5-Triazin-2-amine, 4,6-dichloro-N-[3-(trifluoromethyl)phenyl]-
• 4,6-Dichloro-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine

N2-[3-(Trifluoromethyl)phenyl]-4,6-dichloro-1,3,5-triazin-2-amine

CAS: 2394-87-8

N2-[3-(Trifluoromethyl)phenyl]-4,6-dichloro-1,3,5-triazin-2-amine

Purity: ≥95%

Molecular weight: 309.07g/mol

Ref: 54-PC31156