CAS 23943-96-6
:(2R)-2-methoxypropanoate
Description:
(2R)-2-methoxypropanoate, also known as (R)-2-methoxypropanoic acid, is an ester derived from the reaction of methanol and 2-methoxypropanoic acid. This compound features a methoxy group (-OCH3) attached to a propanoate backbone, which contributes to its unique chemical properties. It is typically a colorless liquid with a pleasant odor, and it is soluble in organic solvents due to its polar functional groups. The presence of the methoxy group enhances its reactivity, making it useful in various chemical syntheses and applications, including as a solvent or an intermediate in organic reactions. The compound exhibits typical ester characteristics, such as lower boiling points compared to their corresponding acids and the ability to undergo hydrolysis in the presence of water or acids. Additionally, (2R)-2-methoxypropanoate may have applications in the pharmaceutical and fragrance industries, although specific uses can vary based on its reactivity and compatibility with other substances. Safety data should be consulted for handling and storage guidelines.
Formula:C4H7O3
InChI:InChI=1/C4H8O3/c1-3(7-2)4(5)6/h3H,1-2H3,(H,5,6)/p-1/t3-/m1/s1
SMILES:C[C@H](C(=O)[O-])OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2R)-2-Methoxypropanoic acid
CAS:Formula:C4H8O3Purity:95%Color and Shape:LiquidMolecular weight:104.1045Ref: IN-DA0032E0
100gTo inquire250gTo inquire500gTo inquire100mg29.00€250mg36.00€1g64.00€10g189.00€5g191.00€25g642.00€(R)-(+)-2-Methoxypropanoic acid
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:104.1050033569336(R)-(+)-2-Methoxypropionic acid
CAS:(R)-(+)-2-Methoxypropionic acid is a derivatization agent that is used to label branched-chain amino acids. It has been shown to react with l-rhamnose, which is found in glycoproteins and polysaccharides.
Formula:C4H8O3Purity:Min. 95%Color and Shape:Clear Colourless To Pale Yellow LiquidMolecular weight:104.1 g/mol(R)-(+)-2-Methoxypropionic Acid
CAS:Controlled ProductApplications (R)-(+)-2-Methoxypropionic Acid (cas# 23943-96-6) is a compound useful in organic synthesis.
Formula:C4H8O3Color and Shape:NeatMolecular weight:104.1




