CAS 23945-44-0: 1,2,3,4-Tetrahydro-2,4-dioxo-5-pyrimidinecarboxylic acid
Description:1,2,3,4-Tetrahydro-2,4-dioxo-5-pyrimidinecarboxylic acid, with the CAS number 23945-44-0, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the ring, resulting in a saturated form. The presence of two carbonyl groups (dioxo) contributes to its reactivity and potential as a precursor in various chemical syntheses. Additionally, the carboxylic acid functional group enhances its solubility in polar solvents and allows for potential interactions in biological systems. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C5H4N2O4
InChI:InChI=1S/C5H4N2O4/c8-3-2(4(9)10)1-6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)
InChI key:InChIKey=ZXYAAVBXHKCJJB-UHFFFAOYSA-N
SMILES:O=C(O)C1=CNC(=O)NC1=O
- Synonyms:
- 1,2,3,4-Tetrahydro-2,4-dioxo-5-pyrimidinecarboxylic acid
- 2,4-Dihydroxy-5-pyrimidinecarboxylic acid
- 2,4-Dihydroxypyrimidine-5-Carboxylic acid hydrate
- 2,4-Dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid
- 2,4-Dioxo-1H-pyrimidine-5-carboxylic acid
- 5-Carboxy-2,4-dihydroxypyrimidine
- 5-Carboxyuracil
- 5-Pyrimidinecarboxylic acid, 1,2,3,4-tetrahydro-2,4-dioxo-
- 5-Pyrimidinecarboxylic acid, 2,4-dihydroxy-
- 5-Uracilcarboxylic acid
- See more synonyms
- Isoorotic acid
- NSC 1589
- NSC 79561
