CAS 23945-44-0
:1,2,3,4-Tetrahydro-2,4-dioxo-5-pyrimidinecarboxylic acid
Description:
1,2,3,4-Tetrahydro-2,4-dioxo-5-pyrimidinecarboxylic acid, with the CAS number 23945-44-0, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the ring, resulting in a saturated form. The presence of two carbonyl groups (dioxo) contributes to its reactivity and potential as a precursor in various chemical syntheses. Additionally, the carboxylic acid functional group enhances its solubility in polar solvents and allows for potential interactions in biological systems. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C5H4N2O4
InChI:InChI=1S/C5H4N2O4/c8-3-2(4(9)10)1-6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)
InChI key:InChIKey=ZXYAAVBXHKCJJB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=O)NC(=O)NC1
Synonyms:- 1,2,3,4-Tetrahydro-2,4-dioxo-5-pyrimidinecarboxylic acid
- 2,4-Dihydroxy-5-pyrimidinecarboxylic acid
- 2,4-Dihydroxypyrimidine-5-Carboxylic acid hydrate
- 2,4-Dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid
- 2,4-Dioxo-1H-pyrimidine-5-carboxylic acid
- 5-Carboxy-2,4-dihydroxypyrimidine
- 5-Carboxyuracil
- 5-Pyrimidinecarboxylic acid, 1,2,3,4-tetrahydro-2,4-dioxo-
- 5-Pyrimidinecarboxylic acid, 2,4-dihydroxy-
- 5-Uracilcarboxylic acid
- Isoorotic acid
- NSC 1589
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
2,4-Dihydroxypyrimidine-5-carboxylic acid
CAS:2,4-Dihydroxypyrimidine-5-carboxylic acidFormula:C5H4N2O4Purity:≥95%Color and Shape:Solid-PowderMolecular weight:156.096262,4-Dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid
CAS:Formula:C5H4N2O4Purity:97%Color and Shape:SolidMolecular weight:156.09632,4-Dihydroxypyrimidine-5-carboxylic acid
CAS:2,4-Dihydroxypyrimidine-5-carboxylic acidFormula:C5H4N2O4Purity:≥98%Molecular weight:156.12,4-Dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic Acid
CAS:Formula:C5H4N2O4Purity:>97.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:156.102,4-Dihydroxypyrimidine-5-carboxylic acid
CAS:2,4-Dihydroxypyrimidine-5-carboxylic acid (Isoorotic acid) has been obtained from 5-formyluracil by the action of enzyme, thymine 7-hydroxylase.Formula:C5H4N2O4Purity:99.09%Color and Shape:Very Slightly Yellow PowderMolecular weight:156.12,4-Dihydroxypyrimidine-5-carboxylic acid anhydrous
CAS:2,4-Dihydroxypyrimidine-5-carboxylic acid anhydrous (2,4DPA) is a metabolite of the drug 2,4-diaminopyrimidine. It inhibits protein synthesis in cells through hydrogen bonding interactions with dna duplexes and has been shown to be toxic to bacteria by inhibiting fatty acid biosynthesis. 2,4DPA is used as a standard in biological assays to measure uptake and light exposure. The analytical method for measuring 2,4DPA relies on hydrochloric acid (HCl) as a solvent that converts the material into its dimethyl ester derivative. This derivative can be quantified by gas chromatography/mass spectrometry (GCMS).Formula:C5H4N2O4Purity:Min. 94.0 Area-%Color and Shape:White Off-White PowderMolecular weight:156.1 g/mol2,4-Dihydroxypyrimidine-5-carboxylic acid
CAS:Formula:C5H4N2O4Purity:97%Color and Shape:SolidMolecular weight:156.0172,4-Dihydroxypyrimidine-5-carboxylic Acid
CAS:2,4-Dihydroxypyrimidine-5-carboxylic acidFormula:C5H4N2O4Purity:98%Molecular weight:156.15-Carboxyuracil extrapure, 98%
CAS:Formula:C5H4N2O4Purity:min. 98%Color and Shape:White, PowderMolecular weight:156.10








