CAS 23947-32-2

3-[(2-methylphenyl)amino]propanoate

Description:

3-[(2-Methylphenyl)amino]propanoate, with the CAS number 23947-32-2, is an organic compound characterized by its structure, which includes a propanoate group attached to an amino group that is further substituted with a 2-methylphenyl moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents due to the presence of the carboxylate functional group. The presence of the aromatic ring contributes to its stability and may influence its reactivity and interaction with biological systems. Additionally, the methyl substitution on the phenyl ring can affect the compound's steric and electronic properties, potentially impacting its biological activity and interactions. As with many organic compounds, its behavior in various environments, including solubility, reactivity, and potential applications in pharmaceuticals or agrochemicals, would depend on specific conditions such as pH, temperature, and the presence of other chemical species.

Formula: C₁₀H₁₂NO₂

InChI: InChI=1/C10H13NO2/c1-8-4-2-3-5-9(8)11-7-6-10(12)13/h2-5,11H,6-7H2,1H3,(H,12,13)/p-1

SMILES: Cc1ccccc1NCCC(=O)[O-]

3-[(2-Methylphenyl)amino]propanoic acid

CAS: 23947-32-2

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₂

Purity: Min. 95%

Molecular weight: 179.22 g/mol

Ref: 3D-YAA94732