CAS 23950-06-3
:(3S,3aR,9aR,9bS)-9b-[2-(dimethylamino)ethyl]-5-methoxy-3,3a,9a,9b-tetrahydrophenanthro[4,5-bcd]furan-3-ol
Description:
The chemical substance with the name "(3S,3aR,9aR,9bS)-9b-[2-(dimethylamino)ethyl]-5-methoxy-3,3a,9a,9b-tetrahydrophenanthro[4,5-bcd]furan-3-ol" and CAS number "23950-06-3" is a complex organic compound characterized by its unique stereochemistry and functional groups. It features a tetrahydrophenanthro-furan core, which contributes to its structural complexity and potential biological activity. The presence of a methoxy group and a dimethylaminoethyl side chain suggests that this compound may exhibit specific interactions with biological targets, possibly influencing its pharmacological properties. The stereochemical configuration indicated by the (3S,3aR,9aR,9bS) notation implies that the compound has multiple chiral centers, which can significantly affect its reactivity and interactions in biological systems. Such compounds are often studied for their potential therapeutic applications, including their effects on neurotransmitter systems or other biological pathways. Overall, this substance represents a class of compounds that may have significant implications in medicinal chemistry and pharmacology.
Formula:C19H23NO3
InChI:InChI=1/C19H23NO3/c1-20(2)11-10-19-13-6-4-12-5-9-15(22-3)17(16(12)19)23-18(19)14(21)8-7-13/h4-9,13-14,18,21H,10-11H2,1-3H3/t13-,14+,18+,19+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
alpha-Codeimethine
CAS:Controlled ProductFormula:C19H23NO3Color and Shape:NeatMolecular weight:313.39

