
CAS 23950-98-3
:2-Methoxy-4-propylcyclohexanol
Description:
2-Methoxy-4-propylcyclohexanol is an organic compound characterized by its cyclohexane ring structure, which is substituted with a methoxy group and a propyl group. The presence of the methoxy group (-OCH3) introduces an ether functional group, while the propyl group contributes to the hydrophobic characteristics of the molecule. This compound is typically a colorless to pale yellow liquid with a pleasant odor, indicative of its potential use in fragrance applications. Its molecular structure suggests moderate polarity due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its solubility in various solvents. The compound may exhibit moderate volatility and is likely to have a relatively low toxicity profile, although specific safety data should be consulted for handling and usage. Additionally, its unique structure may impart specific reactivity patterns, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. As with all chemical substances, proper safety measures should be observed when handling 2-Methoxy-4-propylcyclohexanol.
Formula:C10H20O2
InChI:InChI=1S/C10H20O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h8-11H,3-7H2,1-2H3
InChI key:InChIKey=FLNSLKJOWVMPEE-UHFFFAOYSA-N
SMILES:O(C)C1CC(CCC)CCC1O
Synonyms:- 2-Methoxy-4-propylcyclohexan-1-ol
- 2-Methoxy-4-propylcyclohexanol
- Cyclohexanol, 2-methoxy-4-propyl-
- Tarragol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Methoxy-4-propylcyclohexan-1-ol
CAS:2-Methoxy-4-propylcyclohexan-1-ol is a versatile compound with various applications. It is commonly used as an anesthetic and can be found in research chemicals. This compound has been shown to have colloidal properties, making it suitable for use in the formulation of various products. Additionally, 2-Methoxy-4-propylcyclohexan-1-ol has been studied for its potential therapeutic effects on conditions such as casein-related disorders and fatty acid metabolism. Its unique structure allows it to interact with different biological pathways, including protein kinase signaling and carotenoid synthesis. Overall, this compound offers a wide range of possibilities for scientific research and product development.Formula:C10H20O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:172.26 g/mol
