CAS 23956-11-8
:5-(2-hydroxyethyl)-2-thioxo-2,3-dihydropyrimidin-4(1H)-one
Description:
5-(2-Hydroxyethyl)-2-thioxo-2,3-dihydropyrimidin-4(1H)-one, with the CAS number 23956-11-8, is a chemical compound that belongs to the class of pyrimidinones. This substance features a thioxo group, which contributes to its reactivity and potential biological activity. The presence of a hydroxyethyl group enhances its solubility in polar solvents, making it more amenable for various applications in medicinal chemistry and drug development. The compound exhibits characteristics typical of heterocyclic compounds, including the ability to participate in hydrogen bonding due to the hydroxyl group and the potential for tautomerism involving the thioxo and keto forms. Its structural features suggest possible interactions with biological targets, which may lead to pharmacological effects. Additionally, the compound may be synthesized through various organic reactions involving pyrimidine derivatives, and its stability can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structure and functional groups make it a subject of interest in chemical research and potential therapeutic applications.
Formula:C6H8N2O2S
InChI:InChI=1/C6H8N2O2S/c9-2-1-4-3-7-6(11)8-5(4)10/h3,9H,1-2H2,(H2,7,8,10,11)
SMILES:C(CO)c1cnc(nc1O)S
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(2-Hydroxyethyl)-2-thiouracil
CAS:5-(2-Hydroxyethyl)-2-thiouracil bolongs toIntermediates and Building Blocks - Nucleoside base, Nucleophile; Heterocylic Compounds - Pyrimidine; Scaffold andFormula:C6H8N2O2SColor and Shape:SolidMolecular weight:172.2Ref: TM-TNU0871
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire
