CAS 2396-05-6

Ethanone, 1-[4-(dimethylamino)phenyl]-2,2,2-trifluoro-

Description:

Ethanone, 1-[4-(dimethylamino)phenyl]-2,2,2-trifluoro-, commonly known as a trifluoromethyl ketone, is an organic compound characterized by its distinctive trifluoromethyl group and a dimethylamino substituent on the aromatic ring. This compound typically exhibits a colorless to pale yellow appearance and is known for its relatively low volatility. It has a significant dipole moment due to the electronegative fluorine atoms, which contributes to its reactivity and solubility in polar solvents. The presence of the dimethylamino group enhances its basicity and can influence its behavior in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the trifluoromethyl group imparts unique electronic properties, making this compound of interest in medicinal chemistry and materials science. Safety considerations should be taken into account, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence. Proper handling and disposal protocols are essential when working with this substance.

Formula: C₁₀H₁₀F₃NO

InChI: InChI=1/C10H10F3NO/c1-14(2)8-5-3-7(4-6-8)9(15)10(11,12)13/h3-6H,1-2H3

SMILES: CN(C)c1ccc(cc1)C(=O)C(F)(F)F

Synonyms:

• 1-[4-(Dimethylamino)phenyl]-2,2,2-trifluoro-ethanone
• 4-(Dimethylamino)-2,2,2-trifluoroacetophenone
• 1-(4-(Dimethylamino)Phenyl)-2,2,2-Trifluoroethanone
• 1-(4-Dimethylaminophenyl)-2,2,2-trifluoroethanone

1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethan-1-one

CAS: 2396-05-6

Formula: C₁₀H₁₀F₃NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 217.1877

Ref: IN-DA003KLJ

1-(4-(Dimethylamino)Phenyl)-2,2,2-Trifluoroethanone

CAS: 2396-05-6

1-(4-(Dimethylamino)Phenyl)-2,2,2-Trifluoroethanone

Purity: 98%

Molecular weight: 217.19g/mol

Ref: 54-PC105025