CAS 2396-43-2
:2,4,6-Tripropyl-1,3,5-trioxane
Description:
2,4,6-Tripropyl-1,3,5-trioxane is a cyclic organic compound characterized by its unique trioxane structure, which consists of a six-membered ring containing three oxygen atoms and three carbon atoms. This compound is notable for its potential applications in various fields, including as a potential antimalarial agent due to its ability to generate reactive oxygen species. The presence of three propyl groups attached to the carbon atoms enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. 2,4,6-Tripropyl-1,3,5-trioxane is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is relatively stable under normal conditions but may undergo decomposition or polymerization when exposed to heat or light. Safety data indicates that it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound exemplifies the diverse chemistry of trioxanes and their potential utility in medicinal chemistry and other applications.
Formula:C12H24O3
InChI:InChI=1S/C12H24O3/c1-4-7-10-13-11(8-5-2)15-12(14-10)9-6-3/h10-12H,4-9H2,1-3H3
InChI key:InChIKey=OXSRKPVVVMMMER-UHFFFAOYSA-N
SMILES:C(CC)C1OC(CCC)OC(CCC)O1
Synonyms:- 1,3,5-Trioxane, 2,4,6-tripropyl-
- 2,4,6-Tri-n-propyl-1,3,5-trioxane
- 2,4,6-Tris(n-propyl)-1,3,5-trioxane
- Parabutyraldehyde
- s-Trioxane, 2,4,6-tripropyl-
- 2,4,6-Tripropyl-1,3,5-trioxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
