CAS 23964-37-6

3,5-diiodo-4-methoxybenzohydrazide

Description:

3,5-Diiodo-4-methoxybenzohydrazide is a chemical compound characterized by its specific functional groups and structural features. It contains a benzene ring substituted with two iodine atoms at the 3 and 5 positions, and a methoxy group (-OCH3) at the 4 position, along with a hydrazide functional group (-NH-NH2) attached to a carboxylic acid derivative. This compound is typically used in organic synthesis and may exhibit biological activity, making it of interest in medicinal chemistry. Its iodine substituents can enhance its reactivity and potential applications in imaging or therapeutic agents. The presence of the methoxy group can influence its solubility and reactivity, while the hydrazide moiety may contribute to its ability to form coordination complexes or participate in various chemical reactions. Overall, 3,5-diiodo-4-methoxybenzohydrazide is a versatile compound with potential applications in research and development within the fields of chemistry and pharmacology.

Formula: C₈H₈I₂N₂O₂

InChI: InChI=1/C8H8I2N2O2/c1-14-7-5(9)2-4(3-6(7)10)8(13)12-11/h2-3H,11H2,1H3,(H,12,13)

SMILES: COc1c(cc(cc1I)C(=NN)O)I

3,5-Diiodo-4-methoxybenzhydrazide

CAS: 23964-37-6

3,5-Diiodo-4-methoxybenzhydrazide is a high quality chemical that is useful in the preparation of complex compounds. This compound has been shown to be an excellent reagent and useful intermediate for the synthesis of various fine chemicals. It has been used as a precursor for the production of the antiviral drug Tamiflu, among other pharmaceuticals. 3,5-Diiodo-4-methoxybenzhydrazide is also a versatile building block that can be used in research or as a reaction component in organic synthesis.

Formula: C₈H₈I₂N₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 417.97 g/mol

Ref: 3D-FD69865