CAS 23974-15-4
:N-(pyridin-4-ylmethyl)acetamide
Description:
N-(pyridin-4-ylmethyl)acetamide, with the CAS number 23974-15-4, is an organic compound characterized by its amide functional group and a pyridine ring. This compound features a pyridin-4-ylmethyl group attached to an acetamide moiety, which contributes to its potential biological activity. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, reflecting its polar nature due to the presence of the amide group. The compound may exhibit various chemical properties, including the ability to participate in hydrogen bonding, which can influence its reactivity and interactions with other molecules. N-(pyridin-4-ylmethyl)acetamide may be of interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of drugs targeting specific biological pathways. Its synthesis often involves the reaction of pyridine derivatives with acetic anhydride or acetic acid, highlighting its relevance in organic synthesis and pharmaceutical research.
Formula:C8H10N2O
InChI:InChI=1/C8H10N2O/c1-7(11)10-6-8-2-4-9-5-3-8/h2-5H,6H2,1H3,(H,10,11)
SMILES:CC(=NCc1ccncc1)O
Synonyms:- Acetamide, N-(4-pyridinylmethyl)-
- N-(Pyridin-4-ylmethyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
