CAS 2398-16-5
:cyclobutane-1,3-dicarboxylic acid
Description:
Cyclobutane-1,3-dicarboxylic acid, with the CAS number 2398-16-5, is a cyclic dicarboxylic acid characterized by its four-membered cyclobutane ring structure, which features two carboxylic acid functional groups located at the 1 and 3 positions. This compound is a colorless solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid groups. The presence of these functional groups also imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Cyclobutane-1,3-dicarboxylic acid can undergo decarboxylation under certain conditions, leading to the formation of smaller cyclic or acyclic compounds. Its unique structure and reactivity make it of interest in organic synthesis and materials science, particularly in the development of polymers and other functional materials. Additionally, its relatively low molecular weight and the rigidity of the cyclobutane ring contribute to its distinctive chemical behavior compared to other dicarboxylic acids.
Formula:C6H8O4
InChI:InChI=1/C6H8O4/c7-5(8)3-1-4(2-3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)
SMILES:C1C(CC1C(=O)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
cis-Cyclobutane-1,3-dicarboxylic acid
CAS:Formula:C6H8O4Purity:97%Color and Shape:SolidMolecular weight:144.1253cis-cyclobutane-1,3-dicarboxylic acid
CAS:Cis-cyclobutane-1,3-dicarboxylic acid is a molecule that belongs to the class of cycloalkanes. It is an organic compound with the chemical formula CH2=C(CH3)2COOH. The chemical structure consists of a six-carbon ring in which one carbon atom is bonded to three other carbon atoms and two oxygen atoms. Cis-cyclobutane-1,3-dicarboxylic acid has been used as a starting material for organic synthesis, such as the conversion to malonic acid. This reaction system can be optimized by using techniques such as spectrometry analyses and sustainable methods.Formula:C6H8O4Purity:Min. 95%Molecular weight:144.13 g/mol
