CAS 2398-81-4
:Nicotinic acid N-oxide
Description:
Nicotinic acid N-oxide, with the CAS number 2398-81-4, is a derivative of nicotinic acid, also known as niacin or vitamin B3. This compound features a pyridine ring with a carboxylic acid group and an N-oxide functional group, which is characterized by the presence of an oxygen atom bonded to the nitrogen atom of the pyridine. Nicotinic acid N-oxide is typically a white to off-white solid that is soluble in water and polar organic solvents. It exhibits properties associated with both nicotinic acid and its derivatives, including potential roles in biological systems and pharmacological activities. The compound may participate in various chemical reactions, including oxidation and reduction processes, and can serve as an intermediate in the synthesis of other biologically active molecules. Its structural characteristics contribute to its reactivity and interactions in biochemical pathways, making it of interest in both medicinal chemistry and nutritional studies.
Formula:C6H5NO3
InChI:InChI=1S/C6H5NO3/c8-6(9)5-2-1-3-7(10)4-5/h1-4H,(H,8,9)
InChI key:InChIKey=FJCFFCXMEXZEIM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CN(=O)=CC=C1
Synonyms:- 1-Oxidopyridin-1-ium-3-carboxylic acid
- 3-Carboxypyridin-1-ium-1-olate
- 3-Carboxypyridine 1-oxide
- 3-Carboxypyridine N-oxide
- 3-Pyridinecarboxylic acid oxide
- 3-Pyridinecarboxylic acid, 1-oxide
- N-Hydroxynicotinic acid
- N-oxidenicotinic acid
- NSC 93890
- Nicotinic acid oxide
- Nicotinic acid, 1-oxide
- NicotinicacidN-oxide
- Oxiniacic acid
- Oxiniacic acid~Pyridine-3-carboxylic acid N-oxide
- Pyridine-3-Carboxylate 1-Oxide
- Pyridine-3-Carboxylic Acid 1-Oxide
- Pyridine-3-carboxylic acid N-oxide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Nicotinic Acid N-Oxide
CAS:Formula:C6H5NO3Purity:>98.0%(T)Color and Shape:White to Light yellow to Dark green powder to crystalMolecular weight:139.11Nicotinic acid N-oxide
CAS:Nicotinic acid N-oxide (Nicotinic acid 1-oxide) is a nicotinic acid derivative, used to treat hyperlipoidemia.
Formula:C6H5NO3Purity:99.93%Color and Shape:Beige Fine Crystalline PowderMolecular weight:139.11Pyridine-3-Carboxylic Acid 1-Oxide
CAS:Pyridine-3-Carboxylic Acid 1-OxidePurity:98%Molecular weight:139.11g/mol3-Carboxy-1-oxidopyridin-1-ium
CAS:Formula:C6H5NO3Purity:95+%Color and Shape:SolidMolecular weight:139.11






