CAS 23988-58-1

3-{[2-(4H-1,2,4-triazol-3-ylthio)ethyl]thio}-4H-1,2,4-triazole

Description:

3-{[2-(4H-1,2,4-triazol-3-ylthio)ethyl]thio}-4H-1,2,4-triazole, with CAS number 23988-58-1, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a thioether linkage, connecting two triazole moieties through an ethylthio group, which contributes to its unique chemical properties. It is often studied for its potential applications in agriculture, particularly as a fungicide or herbicide, due to its ability to inhibit specific biological pathways in target organisms. The presence of the triazole functional group is significant, as it is known for its role in disrupting the biosynthesis of ergosterol, a critical component of fungal cell membranes. Additionally, the compound may exhibit various physical properties such as solubility in organic solvents, stability under certain conditions, and specific reactivity patterns, making it of interest in both synthetic and medicinal chemistry. Its biological activity and potential applications continue to be explored in research settings.

Formula: C₆H₈N₆S₂

InChI: InChI=1/C6H8N6S2/c1(13-5-7-3-9-11-5)2-14-6-8-4-10-12-6/h3-4H,1-2H2,(H,7,9,11)(H,8,10,12)

SMILES: C(CSc1nc[nH]n1)Sc1nc[nH]n1

Synonyms:

• 5,5'-(ethane-1,2-diyldisulfanediyl)bis(1H-1,2,4-triazole)

1,2-Bis(4H-1,2,4-triazol-3-ylthio)ethane

CAS: 23988-58-1

1,2-Bis(4H-1,2,4-triazol-3-ylthio)ethane

Purity: ≥95%

Color and Shape: Pale Yellow Solid

Molecular weight: 228.30g/mol

Ref: 54-OR2437