CAS 23994-20-9
:4-chloroisoquinoline-1-carbonitrile
Description:
4-Chloroisoquinoline-1-carbonitrile is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring system. The presence of a chlorine atom at the 4-position and a cyano group (-C≡N) at the 1-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. It may exhibit various biological activities, including antimicrobial and anticancer properties, making it of interest in drug discovery. The compound is also relevant in synthetic organic chemistry as a building block for more complex molecules. Its reactivity can be influenced by the electron-withdrawing nature of the cyano group and the electronegative chlorine atom, which can affect nucleophilic and electrophilic reactions. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C10H5ClN2
InChI:InChI=1/C10H5ClN2/c11-9-6-13-10(5-12)8-4-2-1-3-7(8)9/h1-4,6H
SMILES:c1ccc2c(c1)c(cnc2C#N)Cl
Synonyms:- 1-Isoquinolinecarbonitrile, 4-chloro-
- 4-Chloroisoquinoline-1-carbonitrile
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

