CymitQuimica logo

CAS 24005-61-6

:

Pyrazinecarboxylic acid, 6-methoxy-

Description:
Pyrazinecarboxylic acid, 6-methoxy- is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) and a methoxy group (-OCH3) attached to the pyrazine ring, specifically at the 6-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. Pyrazine derivatives are known for their biological activity, and the methoxy substitution can influence the compound's solubility and interaction with biological targets. The compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the carboxylic acid group. Its CAS number, 24005-61-6, is a unique identifier that facilitates the identification and study of this specific chemical in scientific literature and databases. Overall, pyrazinecarboxylic acid, 6-methoxy- is of interest for its potential utility in synthetic chemistry and medicinal applications.
Formula:C6H6N2O3
InChI:InChI=1/C6H6N2O3/c1-11-5-3-7-2-4(8-5)6(9)10/h2-3H,1H3,(H,9,10)
InChI key:RWGSCFHUIFPLEI-UHFFFAOYSA-N
SMILES:COc1cncc(C(=O)O)n1
Synonyms:
  • 6-Methoxy-pyrazinecarboxylic acid
  • 6-Methoxypyrazine-2-Carboxylic Acid
Found 4 products.