CAS 24027-06-3
:3-hydroxy-1-methyl-pyridin-1-ium-2-carboxamide chloride
Description:
3-Hydroxy-1-methyl-pyridin-1-ium-2-carboxamide chloride, with the CAS number 24027-06-3, is a chemical compound that features a pyridine ring substituted with a hydroxyl group and a carboxamide group, along with a methyl group. This compound is characterized by its quaternary ammonium structure, which contributes to its solubility in polar solvents. The presence of the hydroxyl group enhances its potential for hydrogen bonding, influencing its reactivity and interaction with biological systems. The carboxamide functional group can participate in various chemical reactions, including amide bond formation and hydrolysis. As a chloride salt, it is likely to exhibit ionic characteristics, which can affect its stability and solubility in aqueous environments. This compound may have applications in pharmaceuticals or biochemistry, particularly in studies involving pyridine derivatives or as a potential ligand in coordination chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature reference for precise values.
Formula:C7H9ClN2O2
InChI:InChI=1/C7H8N2O2.ClH/c1-9-4-2-3-5(10)6(9)7(8)11;/h2-4H,1H3,(H2-,8,10,11);1H
SMILES:C[n+]1cccc(c1C(=N)[O-])O.Cl
Synonyms:- 2-Carbamoyl-3-Hydroxy-1-Methylpyridinium Chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.